C22H19N3O3 — CID 166098619
7-isoquinolin-4-yl-2-(2-methoxyphenyl)-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 166098619) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 7-isoquinolin-4-yl-2-(2-methoxyphenyl)-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 7-isoquinolin-4-yl-2-(2-methoxyphenyl)-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 166098619 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 7-isoquinolin-4-yl-2-(2-methoxyphenyl)-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | COc1ccccc1C1CC2(C1)NC(=O)N(c1cncc3ccccc13)C2=O |
| InChI | InChI=1S/C22H19N3O3/c1-28-19-9-5-4-8-17(19)15-10-22(11-15)20(26)25(21(27)24-22)18-13-23-12-14-6-2-3-7-16(14)18/h2-9,12-13,15H,10-11H2,1H3,(H,24,27) |
| InChIKey | HNEFARNHWPQPSQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|