C19H17Cl2F2N5 — CID 166098772
(1R)-N-cyano-N'-(4,5-dichloro-2-fluorophenyl)-1-ethyl-5-fluoro-3-methyl-3,4-dihydro-1H-2,6-naphthyridine-2-carboximidamide (PubChem CID 166098772) has the molecular formula C19H17Cl2F2N5 and a molecular weight of 424.28 g/mol. Its IUPAC name is (1R)-N-cyano-N'-(4,5-dichloro-2-fluorophenyl)-1-ethyl-5-fluoro-3-methyl-3,4-dihydro-1H-2,6-naphthyridine-2-carboximidamide.
| Compound Name | (1R)-N-cyano-N'-(4,5-dichloro-2-fluorophenyl)-1-ethyl-5-fluoro-3-methyl-3,4-dihydro-1H-2,6-naphthyridine-2-carboximidamide |
|---|---|
| PubChem CID | 166098772 |
| Molecular Formula | C19H17Cl2F2N5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (1R)-N-cyano-N'-(4,5-dichloro-2-fluorophenyl)-1-ethyl-5-fluoro-3-methyl-3,4-dihydro-1H-2,6-naphthyridine-2-carboximidamide |
| SMILES | CC[C@@H]1c2ccnc(F)c2CC(C)N1/C(=N/c1cc(Cl)c(Cl)cc1F)NC#N |
| InChI | InChI=1S/C19H17Cl2F2N5/c1-3-17-11-4-5-25-18(23)12(11)6-10(2)28(17)19(26-9-24)27-16-8-14(21)13(20)7-15(16)22/h4-5,7-8,10,17H,3,6H2,1-2H3,(H,26,27)/t10?,17-/m1/s1 |
| InChIKey | JOCKOIQNXVAYHS-NPMYUJNRSA-N |
| XLogP | 5.12 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|