C18H13BrF5N3S — CID 166098781
N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carbothioamide (PubChem CID 166098781) has the molecular formula C18H13BrF5N3S and a molecular weight of 478.28 g/mol. Its IUPAC name is N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carbothioamide.
| Compound Name | N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carbothioamide |
|---|---|
| PubChem CID | 166098781 |
| Molecular Formula | C18H13BrF5N3S |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carbothioamide |
| SMILES | Fc1cc(C(F)(F)F)c(Br)cc1NC(=S)N1C2CCC1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C18H13BrF5N3S/c19-12-7-14(13(20)6-11(12)18(22,23)24)26-17(28)27-8-1-2-15(27)9-3-4-25-16(21)10(9)5-8/h3-4,6-8,15H,1-2,5H2,(H,26,28) |
| InChIKey | BGTQBMPWBFRUBR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|