C19H25F2N5O3 — CID 166099108
6-[4-(difluoromethoxy)-2-(methoxymethoxy)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine (PubChem CID 166099108) has the molecular formula C19H25F2N5O3 and a molecular weight of 409.44 g/mol. Its IUPAC name is 6-[4-(difluoromethoxy)-2-(methoxymethoxy)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine.
| Compound Name | 6-[4-(difluoromethoxy)-2-(methoxymethoxy)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 166099108 |
| Molecular Formula | C19H25F2N5O3 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 6-[4-(difluoromethoxy)-2-(methoxymethoxy)phenyl]-5-methyl-N-[(3R)-1-methylpiperidin-3-yl]-1,2,4-triazin-3-amine |
| SMILES | COCOc1cc(OC(F)F)ccc1-c1nnc(N[C@@H]2CCCN(C)C2)nc1C |
| InChI | InChI=1S/C19H25F2N5O3/c1-12-17(24-25-19(22-12)23-13-5-4-8-26(2)10-13)15-7-6-14(29-18(20)21)9-16(15)28-11-27-3/h6-7,9,13,18H,4-5,8,10-11H2,1-3H3,(H,22,23,25)/t13-/m1/s1 |
| InChIKey | WAVIWVSKNIUSBT-CYBMUJFWSA-N |
| XLogP | 2.94 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|