C9H13ClN4O2 — CID 166099153
(3S,4R)-4-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxan-3-ol (PubChem CID 166099153) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is (3S,4R)-4-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxan-3-ol |
|---|---|
| PubChem CID | 166099153 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3S,4R)-4-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxan-3-ol |
| SMILES | Cc1nc(N[C@@H]2CCOC[C@H]2O)nnc1Cl |
| InChI | InChI=1S/C9H13ClN4O2/c1-5-8(10)13-14-9(11-5)12-6-2-3-16-4-7(6)15/h6-7,15H,2-4H2,1H3,(H,11,12,14)/t6-,7-/m1/s1 |
| InChIKey | BHFRLUOQGXQNKJ-RNFRBKRXSA-N |
| XLogP | 0.40 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |