C21H25FN4O4 — CID 166099899
tert-butyl 4-[(1S,9S)-6-cyano-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carbonyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 166099899) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is tert-butyl 4-[(1S,9S)-6-cyano-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carbonyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1S,9S)-6-cyano-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carbonyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166099899 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl 4-[(1S,9S)-6-cyano-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carbonyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(C(=O)N2C[C@@H]3C[C@H]2c2cncc(C#N)c2O3)CC1 |
| InChI | InChI=1S/C21H25FN4O4/c1-20(2,3)30-19(28)25-6-4-21(22,5-7-25)18(27)26-12-14-8-16(26)15-11-24-10-13(9-23)17(15)29-14/h10-11,14,16H,4-8,12H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | PUCNIELCGLXBJX-HOCLYGCPSA-N |
| XLogP | 2.73 |
| TPSA | 95.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |