C18H18BrF3N2O2 — CID 166099901
[(1S,9S)-6-bromo-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 166099901) has the molecular formula C18H18BrF3N2O2 and a molecular weight of 431.25 g/mol. Its IUPAC name is [(1S,9S)-6-bromo-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,9S)-6-bromo-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 166099901 |
| Molecular Formula | C18H18BrF3N2O2 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | [(1S,9S)-6-bromo-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(Br)c1O2)C12CCC(C(F)(F)F)(CC1)C2 |
| InChI | InChI=1S/C18H18BrF3N2O2/c19-12-7-23-6-11-13-5-10(26-14(11)12)8-24(13)15(25)16-1-3-17(9-16,4-2-16)18(20,21)22/h6-7,10,13H,1-5,8-9H2/t10-,13-,16?,17?/m0/s1 |
| InChIKey | HHUJBCYCEUSHKM-ZTNNUAGJSA-N |
| XLogP | 4.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |