C24H23FN2O2 — CID 166099930
[(1S,9S)-6-[2-(4-fluorophenyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-(1-methylcyclopentyl)methanone (PubChem CID 166099930) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is [(1S,9S)-6-[2-(4-fluorophenyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-(1-methylcyclopentyl)methanone.
| Compound Name | [(1S,9S)-6-[2-(4-fluorophenyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-(1-methylcyclopentyl)methanone |
|---|---|
| PubChem CID | 166099930 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(1S,9S)-6-[2-(4-fluorophenyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-(1-methylcyclopentyl)methanone |
| SMILES | CC1(C(=O)N2C[C@@H]3C[C@H]2c2cncc(C#Cc4ccc(F)cc4)c2O3)CCCC1 |
| InChI | InChI=1S/C24H23FN2O2/c1-24(10-2-3-11-24)23(28)27-15-19-12-21(27)20-14-26-13-17(22(20)29-19)7-4-16-5-8-18(25)9-6-16/h5-6,8-9,13-14,19,21H,2-3,10-12,15H2,1H3/t19-,21-/m0/s1 |
| InChIKey | PBVAJPGZIHWYCA-FPOVZHCZSA-N |
| XLogP | 4.24 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|