C18H18FN3O2 — CID 166099947
(1S,9S)-11-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile (PubChem CID 166099947) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is (1S,9S)-11-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile.
| Compound Name | (1S,9S)-11-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile |
|---|---|
| PubChem CID | 166099947 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (1S,9S)-11-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile |
| SMILES | N#Cc1cncc2c1O[C@H]1C[C@@H]2N(C(=O)C23CCC(F)(CC2)C3)C1 |
| InChI | InChI=1S/C18H18FN3O2/c19-18-3-1-17(10-18,2-4-18)16(23)22-9-12-5-14(22)13-8-21-7-11(6-20)15(13)24-12/h7-8,12,14H,1-5,9-10H2/t12-,14-,17?,18?/m0/s1 |
| InChIKey | VIYYIXHPUIMTBD-ISGHGUFCSA-N |
| XLogP | 2.66 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |