C25H36F2N2O2Si — CID 166099953
3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-[2-tri(propan-2-yl)silylethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one (PubChem CID 166099953) has the molecular formula C25H36F2N2O2Si and a molecular weight of 462.66 g/mol. Its IUPAC name is 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-[2-tri(propan-2-yl)silylethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one.
| Compound Name | 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-[2-tri(propan-2-yl)silylethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 166099953 |
| Molecular Formula | C25H36F2N2O2Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-[2-tri(propan-2-yl)silylethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one |
| SMILES | CC(C)[Si](C#Cc1cncc2c1O[C@H]1C[C@@H]2N(C(=O)C(C)(C)C(F)F)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H36F2N2O2Si/c1-15(2)32(16(3)4,17(5)6)10-9-18-12-28-13-20-21-11-19(31-22(18)20)14-29(21)24(30)25(7,8)23(26)27/h12-13,15-17,19,21,23H,11,14H2,1-8H3/t19-,21-/m0/s1 |
| InChIKey | STKZXGGUVXTFLX-FPOVZHCZSA-N |
| XLogP | 5.98 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|