C20H20F4N4O2 — CID 166100712
1-[(3R,4R)-3-[(5-fluoropyrimidin-2-yl)amino]-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166100712) has the molecular formula C20H20F4N4O2 and a molecular weight of 424.40 g/mol. Its IUPAC name is 1-[(3R,4R)-3-[(5-fluoropyrimidin-2-yl)amino]-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4R)-3-[(5-fluoropyrimidin-2-yl)amino]-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166100712 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[(3R,4R)-3-[(5-fluoropyrimidin-2-yl)amino]-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](OCc2ccc(C(F)(F)F)cc2)[C@H](Nc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C20H20F4N4O2/c1-2-18(29)28-8-7-17(16(11-28)27-19-25-9-15(21)10-26-19)30-12-13-3-5-14(6-4-13)20(22,23)24/h2-6,9-10,16-17H,1,7-8,11-12H2,(H,25,26,27)/t16-,17-/m1/s1 |
| InChIKey | SFDFWLOUMCBPQJ-IAGOWNOFSA-N |
| XLogP | 3.42 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|