C17H30F3NO — CID 166100740
ethane;3-[(Z,2E)-2-prop-2-enylidenehex-3-enoxy]pyrrolidine;1,1,1-trifluoroethane (PubChem CID 166100740) has the molecular formula C17H30F3NO and a molecular weight of 321.43 g/mol. Its IUPAC name is ethane;3-[(Z,2E)-2-prop-2-enylidenehex-3-enoxy]pyrrolidine;1,1,1-trifluoroethane.
| Compound Name | ethane;3-[(Z,2E)-2-prop-2-enylidenehex-3-enoxy]pyrrolidine;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 166100740 |
| Molecular Formula | C17H30F3NO |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | ethane;3-[(Z,2E)-2-prop-2-enylidenehex-3-enoxy]pyrrolidine;1,1,1-trifluoroethane |
| SMILES | C=C/C=C(\C=C/CC)COC1CCNC1.CC.CC(F)(F)F |
| InChI | InChI=1S/C13H21NO.C2H3F3.C2H6/c1-3-5-7-12(6-4-2)11-15-13-8-9-14-10-13;1-2(3,4)5;1-2/h4-7,13-14H,2-3,8-11H2,1H3;1H3;1-2H3/b7-5-,12-6+;; |
| InChIKey | KDRSBLVOZAXXPO-QXYLOQLYSA-N |
| XLogP | 5.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|