C16H19F3N4O — CID 166100756
pyrimidin-2-amine;3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine (PubChem CID 166100756) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is pyrimidin-2-amine;3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine.
| Compound Name | pyrimidin-2-amine;3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine |
|---|---|
| PubChem CID | 166100756 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | pyrimidin-2-amine;3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine |
| SMILES | FC(F)(F)c1ccc(COC2CCNC2)cc1.Nc1ncccn1 |
| InChI | InChI=1S/C12H14F3NO.C4H5N3/c13-12(14,15)10-3-1-9(2-4-10)8-17-11-5-6-16-7-11;5-4-6-2-1-3-7-4/h1-4,11,16H,5-8H2;1-3H,(H2,5,6,7) |
| InChIKey | NOBBISZMXPCDQF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |