About 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine
5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine (PubChem CID 166100913) has the molecular formula C17H17F4N3O
and a molecular weight of 355.34 g/mol. Its IUPAC name is 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine |
| PubChem CID | 166100913 |
| Molecular Formula | C17H17F4N3O |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine |
| SMILES | Fc1ccc(N[C@@H]2CNC[C@H]2OCc2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H17F4N3O/c18-13-5-6-16(23-7-13)24-14-8-22-9-15(14)25-10-11-1-3-12(4-2-11)17(19,20)21/h1-7,14-15,22H,8-10H2,(H,23,24)/t14-,15-/m1/s1 |
| InChIKey | NNDBICONACXLNG-HUUCEWRRSA-N |
| XLogP | 3.21 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine?
The IUPAC name of 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine (CID 166100913) is 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine.
What is the SMILES notation for 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine?
The canonical SMILES for 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine is Fc1ccc(N[C@@H]2CNC[C@H]2OCc2ccc(C(F)(F)F)cc2)nc1.
What is the InChIKey of 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine?
The InChIKey is NNDBICONACXLNG-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H17F4N3O/c18-13-5-6-16(23-7-13)24-14-8-22-9-15(14)25-10-11-1-3-12(4-2-11)17(19,20)21/h1-7,14-15,22H,8-10H2,(H,23,24)/t14-,15-/m1/s1.
What are the key properties of 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine?
5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine has a molecular weight of 355.34 g/mol, XLogP of 3.21, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-[(3R,4R)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyridin-2-amine is sourced from PubChem (CID 166100913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).