C13H18F3NO — CID 166100988
3-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy]pyrrolidine (PubChem CID 166100988) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy]pyrrolidine.
| Compound Name | 3-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy]pyrrolidine |
|---|---|
| PubChem CID | 166100988 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy]pyrrolidine |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)COC1CCNC1 |
| InChI | InChI=1S/C13H18F3NO/c1-3-11(5-4-10(2)13(14,15)16)9-18-12-6-7-17-8-12/h3-5,12,17H,1,6-9H2,2H3/b10-4+,11-5+ |
| InChIKey | QFEWXTBXRZKCQI-ZVSIBQGLSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|