C24H29F3N5O2+ — CID 166101031
1-[(4S)-3-[(Z)-[4-(1-methylpiperidin-4-yl)triazol-1-ium-1-ylidene]methyl]-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 166101031) has the molecular formula C24H29F3N5O2+ and a molecular weight of 476.52 g/mol. Its IUPAC name is 1-[(4S)-3-[(Z)-[4-(1-methylpiperidin-4-yl)triazol-1-ium-1-ylidene]methyl]-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(4S)-3-[(Z)-[4-(1-methylpiperidin-4-yl)triazol-1-ium-1-ylidene]methyl]-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166101031 |
| Molecular Formula | C24H29F3N5O2+ |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 1-[(4S)-3-[(Z)-[4-(1-methylpiperidin-4-yl)triazol-1-ium-1-ylidene]methyl]-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(/C=[N+]2/C=C(C3CCN(C)CC3)N=N2)[C@H](OCc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H29F3N5O2/c1-3-23(33)31-12-19(13-32-14-21(28-29-32)18-8-10-30(2)11-9-18)22(15-31)34-16-17-4-6-20(7-5-17)24(25,26)27/h3-7,13-14,18-19,22H,1,8-12,15-16H2,2H3/q+1/b32-13-/t19?,22-/m1/s1 |
| InChIKey | UUOZAHFVACLWOR-YXBSVYPUSA-N |
| XLogP | 3.88 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|