C19H18ClF2N5O — CID 166101432
4-chloro-6-[1-(difluoromethyl)-4-[[2-(prop-2-enoxymethyl)phenyl]methyl]pyrazol-3-yl]pyrimidin-2-amine (PubChem CID 166101432) has the molecular formula C19H18ClF2N5O and a molecular weight of 405.84 g/mol. Its IUPAC name is 4-chloro-6-[1-(difluoromethyl)-4-[[2-(prop-2-enoxymethyl)phenyl]methyl]pyrazol-3-yl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[1-(difluoromethyl)-4-[[2-(prop-2-enoxymethyl)phenyl]methyl]pyrazol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166101432 |
| Molecular Formula | C19H18ClF2N5O |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-chloro-6-[1-(difluoromethyl)-4-[[2-(prop-2-enoxymethyl)phenyl]methyl]pyrazol-3-yl]pyrimidin-2-amine |
| SMILES | C=CCOCc1ccccc1Cc1cn(C(F)F)nc1-c1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C19H18ClF2N5O/c1-2-7-28-11-13-6-4-3-5-12(13)8-14-10-27(18(21)22)26-17(14)15-9-16(20)25-19(23)24-15/h2-6,9-10,18H,1,7-8,11H2,(H2,23,24,25) |
| InChIKey | FAZXPFKYEPDOLW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|