C26H20F2N2O2 — CID 166102194
(4-amino-3,5-difluorophenyl)-(3-methyl-9-oxa-13-azapentacyclo[11.6.1.02,7.08,10.016,20]icosa-1(19),2,4,6,14,16(20),17-heptaen-15-yl)methanone (PubChem CID 166102194) has the molecular formula C26H20F2N2O2 and a molecular weight of 430.45 g/mol. Its IUPAC name is (4-amino-3,5-difluorophenyl)-(3-methyl-9-oxa-13-azapentacyclo[11.6.1.02,7.08,10.016,20]icosa-1(19),2,4,6,14,16(20),17-heptaen-15-yl)methanone.
| Compound Name | (4-amino-3,5-difluorophenyl)-(3-methyl-9-oxa-13-azapentacyclo[11.6.1.02,7.08,10.016,20]icosa-1(19),2,4,6,14,16(20),17-heptaen-15-yl)methanone |
|---|---|
| PubChem CID | 166102194 |
| Molecular Formula | C26H20F2N2O2 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4-amino-3,5-difluorophenyl)-(3-methyl-9-oxa-13-azapentacyclo[11.6.1.02,7.08,10.016,20]icosa-1(19),2,4,6,14,16(20),17-heptaen-15-yl)methanone |
| SMILES | Cc1cccc2c1-c1cccc3c(C(=O)c4cc(F)c(N)c(F)c4)cn(c13)CCC1OC21 |
| InChI | InChI=1S/C26H20F2N2O2/c1-13-4-2-7-17-22(13)16-6-3-5-15-18(12-30(24(15)16)9-8-21-26(17)32-21)25(31)14-10-19(27)23(29)20(28)11-14/h2-7,10-12,21,26H,8-9,29H2,1H3 |
| InChIKey | CYKPMFUGCBQGHP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|