C29H24F3N3O3S — CID 166102234
[3-methoxy-6-(2-methoxyethyl)-7-methyl-11-thia-6,8,17-triazapentacyclo[12.6.1.02,10.05,9.017,21]henicosa-1(20),2,4,7,9,14(21),15,18-octaen-16-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 166102234) has the molecular formula C29H24F3N3O3S and a molecular weight of 551.59 g/mol. Its IUPAC name is [3-methoxy-6-(2-methoxyethyl)-7-methyl-11-thia-6,8,17-triazapentacyclo[12.6.1.02,10.05,9.017,21]henicosa-1(20),2,4,7,9,14(21),15,18-octaen-16-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [3-methoxy-6-(2-methoxyethyl)-7-methyl-11-thia-6,8,17-triazapentacyclo[12.6.1.02,10.05,9.017,21]henicosa-1(20),2,4,7,9,14(21),15,18-octaen-16-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 166102234 |
| Molecular Formula | C29H24F3N3O3S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | [3-methoxy-6-(2-methoxyethyl)-7-methyl-11-thia-6,8,17-triazapentacyclo[12.6.1.02,10.05,9.017,21]henicosa-1(20),2,4,7,9,14(21),15,18-octaen-16-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | COCCn1c(C)nc2c3c(c(OC)cc21)-c1cccn2c(C(=O)c4cc(F)c(F)c(F)c4)cc(c12)CCS3 |
| InChI | InChI=1S/C29H24F3N3O3S/c1-15-33-26-21(34(15)8-9-37-2)14-23(38-3)24-18-5-4-7-35-22(13-16(27(18)35)6-10-39-29(24)26)28(36)17-11-19(30)25(32)20(31)12-17/h4-5,7,11-14H,6,8-10H2,1-3H3 |
| InChIKey | OCMMXVLIJKLDOG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|