C25H26BF3N2O4 — CID 166102368
[2-(oxan-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 166102368) has the molecular formula C25H26BF3N2O4 and a molecular weight of 486.30 g/mol. Its IUPAC name is [2-(oxan-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [2-(oxan-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 166102368 |
| Molecular Formula | C25H26BF3N2O4 |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [2-(oxan-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | CC1(C)OB(c2cccc3c(C(=O)c4cc(F)c(F)c(F)c4)n(C4CCCCO4)nc23)OC1(C)C |
| InChI | InChI=1S/C25H26BF3N2O4/c1-24(2)25(3,4)35-26(34-24)16-9-7-8-15-21(16)30-31(19-10-5-6-11-33-19)22(15)23(32)14-12-17(27)20(29)18(28)13-14/h7-9,12-13,19H,5-6,10-11H2,1-4H3 |
| InChIKey | GCMBZCRCBKTDJW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|