About 1-fluoro-3,6-diazabicyclo[3.1.1]heptane
1-fluoro-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 166102696) has the molecular formula C5H9FN2
and a molecular weight of 116.14 g/mol. Its IUPAC name is 1-fluoro-3,6-diazabicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | 1-fluoro-3,6-diazabicyclo[3.1.1]heptane |
| PubChem CID | 166102696 |
| Molecular Formula | C5H9FN2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | 1-fluoro-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | FC12CNCC(C1)N2 |
| InChI | InChI=1S/C5H9FN2/c6-5-1-4(8-5)2-7-3-5/h4,7-8H,1-3H2 |
| InChIKey | AIOPQVUCVVNEGE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3,6-diazabicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3,6-diazabicyclo[3.1.1]heptane?
The IUPAC name of 1-fluoro-3,6-diazabicyclo[3.1.1]heptane (CID 166102696) is 1-fluoro-3,6-diazabicyclo[3.1.1]heptane.
What is the SMILES notation for 1-fluoro-3,6-diazabicyclo[3.1.1]heptane?
The canonical SMILES for 1-fluoro-3,6-diazabicyclo[3.1.1]heptane is FC12CNCC(C1)N2.
What is the InChIKey of 1-fluoro-3,6-diazabicyclo[3.1.1]heptane?
The InChIKey is AIOPQVUCVVNEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FN2/c6-5-1-4(8-5)2-7-3-5/h4,7-8H,1-3H2.
What are the key properties of 1-fluoro-3,6-diazabicyclo[3.1.1]heptane?
1-fluoro-3,6-diazabicyclo[3.1.1]heptane has a molecular weight of 116.14 g/mol, XLogP of -0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3,6-diazabicyclo[3.1.1]heptane is sourced from PubChem (CID 166102696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).