About N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide
N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide (PubChem CID 166103205) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide.
Molecular Properties
| Compound Name | N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide |
| PubChem CID | 166103205 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NC12CC(C1)C2)OC |
| InChI | InChI=1S/C11H18N2O4/c1-16-8(17-2)6-12-9(14)10(15)13-11-3-7(4-11)5-11/h7-8H,3-6H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | NKJURVIDXFVGCD-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide?
The IUPAC name of N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide (CID 166103205) is N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide.
What is the SMILES notation for N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide?
The canonical SMILES for N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide is COC(CNC(=O)C(=O)NC12CC(C1)C2)OC.
What is the InChIKey of N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide?
The InChIKey is NKJURVIDXFVGCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-16-8(17-2)6-12-9(14)10(15)13-11-3-7(4-11)5-11/h7-8H,3-6H2,1-2H3,(H,12,14)(H,13,15).
What are the key properties of N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide?
N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide has a molecular weight of 242.27 g/mol, XLogP of -0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-bicyclo[1.1.1]pentanyl)-N-(2,2-dimethoxyethyl)oxamide is sourced from PubChem (CID 166103205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).