About 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione
1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione (PubChem CID 166103430) has the molecular formula C19H24F2N4O2
and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione.
Molecular Properties
| Compound Name | 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione |
| PubChem CID | 166103430 |
| Molecular Formula | C19H24F2N4O2 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCCC2)CCN1Cc1ccc(N2CCC(F)(F)C2)nc1 |
| InChI | InChI=1S/C19H24F2N4O2/c20-19(21)7-8-24(13-19)16-6-5-14(11-22-16)12-23-9-10-25(18(27)17(23)26)15-3-1-2-4-15/h5-6,11,15H,1-4,7-10,12-13H2 |
| InChIKey | LRJTYFBSPSBPKP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione?
The IUPAC name of 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione (CID 166103430) is 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione.
What is the SMILES notation for 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione?
The canonical SMILES for 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione is O=C1C(=O)N(C2CCCC2)CCN1Cc1ccc(N2CCC(F)(F)C2)nc1.
What is the InChIKey of 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione?
The InChIKey is LRJTYFBSPSBPKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N4O2/c20-19(21)7-8-24(13-19)16-6-5-14(11-22-16)12-23-9-10-25(18(27)17(23)26)15-3-1-2-4-15/h5-6,11,15H,1-4,7-10,12-13H2.
What are the key properties of 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione?
1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione has a molecular weight of 378.42 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-4-[[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]methyl]piperazine-2,3-dione is sourced from PubChem (CID 166103430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).