C19H18N4O2S — CID 166103473
1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione (PubChem CID 166103473) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 166103473 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione |
| SMILES | O=c1c(=O)n(C2C[C@@H]3C[C@@H]3C2)ccn1Cc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H18N4O2S/c24-18-19(25)23(15-9-13-8-14(13)10-15)7-6-22(18)11-16-20-21-17(26-16)12-4-2-1-3-5-12/h1-7,13-15H,8-11H2/t13-,14+,15? |
| InChIKey | CUJKIJBSINJNMQ-YIONKMFJSA-N |
| XLogP | 2.55 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|