C18H19FN4O2S — CID 166103727
1-cyclopentyl-4-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione (PubChem CID 166103727) has the molecular formula C18H19FN4O2S and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-cyclopentyl-4-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103727 |
| Molecular Formula | C18H19FN4O2S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-cyclopentyl-4-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCCC2)CCN1Cc1nnc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C18H19FN4O2S/c19-14-8-4-3-7-13(14)16-21-20-15(26-16)11-22-9-10-23(18(25)17(22)24)12-5-1-2-6-12/h3-4,7-8,12H,1-2,5-6,9-11H2 |
| InChIKey | GBNRBMBKANPTHL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|