C18H25N7 — CID 166103927
2-[(2,3-dimethylidene-4-propylpiperazin-1-yl)methyl]-5-(triazol-2-yl)pyrazine;ethene (PubChem CID 166103927) has the molecular formula C18H25N7 and a molecular weight of 339.45 g/mol. Its IUPAC name is 2-[(2,3-dimethylidene-4-propylpiperazin-1-yl)methyl]-5-(triazol-2-yl)pyrazine;ethene.
| Compound Name | 2-[(2,3-dimethylidene-4-propylpiperazin-1-yl)methyl]-5-(triazol-2-yl)pyrazine;ethene |
|---|---|
| PubChem CID | 166103927 |
| Molecular Formula | C18H25N7 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-[(2,3-dimethylidene-4-propylpiperazin-1-yl)methyl]-5-(triazol-2-yl)pyrazine;ethene |
| SMILES | C=C.C=C1C(=C)N(Cc2cnc(-n3nccn3)cn2)CCN1CCC |
| InChI | InChI=1S/C16H21N7.C2H4/c1-4-7-21-8-9-22(14(3)13(21)2)12-15-10-18-16(11-17-15)23-19-5-6-20-23;1-2/h5-6,10-11H,2-4,7-9,12H2,1H3;1-2H2 |
| InChIKey | CVYFWNBGNPVLJK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|