About 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione
1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione (PubChem CID 166103933) has the molecular formula C17H19N5O2S
and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione.
Molecular Properties
| Compound Name | 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione |
| PubChem CID | 166103933 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCCC2)CCN1Cc1ncc(-c2nccs2)cn1 |
| InChI | InChI=1S/C17H19N5O2S/c23-16-17(24)22(13-3-1-2-4-13)7-6-21(16)11-14-19-9-12(10-20-14)15-18-5-8-25-15/h5,8-10,13H,1-4,6-7,11H2 |
| InChIKey | GIEUOKYLXKEBPK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione?
The IUPAC name of 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione (CID 166103933) is 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione.
What is the SMILES notation for 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione?
The canonical SMILES for 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione is O=C1C(=O)N(C2CCCC2)CCN1Cc1ncc(-c2nccs2)cn1.
What is the InChIKey of 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione?
The InChIKey is GIEUOKYLXKEBPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O2S/c23-16-17(24)22(13-3-1-2-4-13)7-6-21(16)11-14-19-9-12(10-20-14)15-18-5-8-25-15/h5,8-10,13H,1-4,6-7,11H2.
What are the key properties of 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione?
1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione has a molecular weight of 357.44 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-4-[[5-(1,3-thiazol-2-yl)pyrimidin-2-yl]methyl]piperazine-2,3-dione is sourced from PubChem (CID 166103933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).