About 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine
1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine (PubChem CID 166104045) has the molecular formula C10H12F2N4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine |
| PubChem CID | 166104045 |
| Molecular Formula | C10H12F2N4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine |
| SMILES | CC(C)c1cnc2cnn(CC(F)F)c2n1 |
| InChI | InChI=1S/C10H12F2N4/c1-6(2)7-3-13-8-4-14-16(5-9(11)12)10(8)15-7/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | SOVUVCPDTVKECY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine?
The IUPAC name of 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine (CID 166104045) is 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine?
The canonical SMILES for 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine is CC(C)c1cnc2cnn(CC(F)F)c2n1.
What is the InChIKey of 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine?
The InChIKey is SOVUVCPDTVKECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N4/c1-6(2)7-3-13-8-4-14-16(5-9(11)12)10(8)15-7/h3-4,6,9H,5H2,1-2H3.
What are the key properties of 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine?
1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine has a molecular weight of 226.23 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-6-propan-2-ylpyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 166104045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).