About 1,6-diethylpyrazolo[3,4-b]pyrazine
1,6-diethylpyrazolo[3,4-b]pyrazine (PubChem CID 166104049) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,6-diethylpyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 1,6-diethylpyrazolo[3,4-b]pyrazine |
| PubChem CID | 166104049 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1,6-diethylpyrazolo[3,4-b]pyrazine |
| SMILES | CCc1cnc2cnn(CC)c2n1 |
| InChI | InChI=1S/C9H12N4/c1-3-7-5-10-8-6-11-13(4-2)9(8)12-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | UONZCJGAWWUJBU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-diethylpyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diethylpyrazolo[3,4-b]pyrazine?
The IUPAC name of 1,6-diethylpyrazolo[3,4-b]pyrazine (CID 166104049) is 1,6-diethylpyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 1,6-diethylpyrazolo[3,4-b]pyrazine?
The canonical SMILES for 1,6-diethylpyrazolo[3,4-b]pyrazine is CCc1cnc2cnn(CC)c2n1.
What is the InChIKey of 1,6-diethylpyrazolo[3,4-b]pyrazine?
The InChIKey is UONZCJGAWWUJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-3-7-5-10-8-6-11-13(4-2)9(8)12-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,6-diethylpyrazolo[3,4-b]pyrazine?
1,6-diethylpyrazolo[3,4-b]pyrazine has a molecular weight of 176.22 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diethylpyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 166104049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).