About 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine
1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine (PubChem CID 166104123) has the molecular formula C8H8F2N4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine |
| PubChem CID | 166104123 |
| Molecular Formula | C8H8F2N4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine |
| SMILES | Cc1cnc2cnn(CC(F)F)c2n1 |
| InChI | InChI=1S/C8H8F2N4/c1-5-2-11-6-3-12-14(4-7(9)10)8(6)13-5/h2-3,7H,4H2,1H3 |
| InChIKey | KDZUSQRSZRFSAX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine?
The IUPAC name of 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine (CID 166104123) is 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine?
The canonical SMILES for 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine is Cc1cnc2cnn(CC(F)F)c2n1.
What is the InChIKey of 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine?
The InChIKey is KDZUSQRSZRFSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N4/c1-5-2-11-6-3-12-14(4-7(9)10)8(6)13-5/h2-3,7H,4H2,1H3.
What are the key properties of 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine?
1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine has a molecular weight of 198.18 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-6-methylpyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 166104123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).