C11H14ClF3N2O — CID 166104292
4-piperidin-4-yloxy-3-(trifluoromethyl)pyridine;hydrochloride (PubChem CID 166104292) has the molecular formula C11H14ClF3N2O and a molecular weight of 282.69 g/mol. Its IUPAC name is 4-piperidin-4-yloxy-3-(trifluoromethyl)pyridine;hydrochloride.
| Compound Name | 4-piperidin-4-yloxy-3-(trifluoromethyl)pyridine;hydrochloride |
|---|---|
| PubChem CID | 166104292 |
| Molecular Formula | C11H14ClF3N2O |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-piperidin-4-yloxy-3-(trifluoromethyl)pyridine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cnccc1OC1CCNCC1 |
| InChI | InChI=1S/C11H13F3N2O.ClH/c12-11(13,14)9-7-16-6-3-10(9)17-8-1-4-15-5-2-8;/h3,6-8,15H,1-2,4-5H2;1H |
| InChIKey | REIIYOKPZDUCCF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |