C11H13F3N4O — CID 166104332
6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[3,4-b]pyrazine (PubChem CID 166104332) has the molecular formula C11H13F3N4O and a molecular weight of 274.25 g/mol. Its IUPAC name is 6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[3,4-b]pyrazine.
| Compound Name | 6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 166104332 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[3,4-b]pyrazine |
| SMILES | CCc1cnc2cnn(CCOCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C11H13F3N4O/c1-2-8-5-15-9-6-16-18(10(9)17-8)3-4-19-7-11(12,13)14/h5-6H,2-4,7H2,1H3 |
| InChIKey | VLDCHZQYEGQGJP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|