C31H35N3O3 — CID 166104980
(4-methoxy-2,8-dimethyl-9-phenyl-6,8-diazatricyclo[5.3.0.01,3]deca-4,6,9-trien-10-yl)-[3-[(2-methylphenoxy)methyl]piperidin-1-yl]methanone (PubChem CID 166104980) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is (4-methoxy-2,8-dimethyl-9-phenyl-6,8-diazatricyclo[5.3.0.01,3]deca-4,6,9-trien-10-yl)-[3-[(2-methylphenoxy)methyl]piperidin-1-yl]methanone.
| Compound Name | (4-methoxy-2,8-dimethyl-9-phenyl-6,8-diazatricyclo[5.3.0.01,3]deca-4,6,9-trien-10-yl)-[3-[(2-methylphenoxy)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 166104980 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (4-methoxy-2,8-dimethyl-9-phenyl-6,8-diazatricyclo[5.3.0.01,3]deca-4,6,9-trien-10-yl)-[3-[(2-methylphenoxy)methyl]piperidin-1-yl]methanone |
| SMILES | COC1=CN=C2N(C)C(c3ccccc3)=C(C(=O)N3CCCC(COc4ccccc4C)C3)C23C(C)C13 |
| InChI | InChI=1S/C31H35N3O3/c1-20-11-8-9-15-24(20)37-19-22-12-10-16-34(18-22)29(35)27-28(23-13-6-5-7-14-23)33(3)30-31(27)21(2)26(31)25(36-4)17-32-30/h5-9,11,13-15,17,21-22,26H,10,12,16,18-19H2,1-4H3 |
| InChIKey | FSCLKOHOUPETAV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |