About 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride
3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride (PubChem CID 166105001) has the molecular formula C12H14ClF5N2O
and a molecular weight of 332.70 g/mol. Its IUPAC name is 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride.
Molecular Properties
| Compound Name | 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride |
| PubChem CID | 166105001 |
| Molecular Formula | C12H14ClF5N2O |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride |
| SMILES | Cl.FC1(F)CNCC(COc2cccnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F5N2O.ClH/c13-11(14)4-8(5-18-7-11)6-20-9-2-1-3-19-10(9)12(15,16)17;/h1-3,8,18H,4-7H2;1H |
| InChIKey | WNQJTXCYMAKXEY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride?
The IUPAC name of 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride (CID 166105001) is 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride.
What is the SMILES notation for 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride?
The canonical SMILES for 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride is Cl.FC1(F)CNCC(COc2cccnc2C(F)(F)F)C1.
What is the InChIKey of 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride?
The InChIKey is WNQJTXCYMAKXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F5N2O.ClH/c13-11(14)4-8(5-18-7-11)6-20-9-2-1-3-19-10(9)12(15,16)17;/h1-3,8,18H,4-7H2;1H.
What are the key properties of 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride?
3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride has a molecular weight of 332.70 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,5-difluoropiperidin-3-yl)methoxy]-2-(trifluoromethyl)pyridine;hydrochloride is sourced from PubChem (CID 166105001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).