About [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride
[(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride (PubChem CID 166105009) has the molecular formula C7H16ClNO
and a molecular weight of 165.66 g/mol. Its IUPAC name is [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride |
| PubChem CID | 166105009 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride |
| SMILES | C[C@H]1CC[C@H](CO)CN1.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-6-2-3-7(5-9)4-8-6;/h6-9H,2-5H2,1H3;1H/t6-,7-;/m0./s1 |
| InChIKey | VTNSDDLUAVIRTL-LEUCUCNGSA-N |
| XLogP | 0.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride?
The IUPAC name of [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride (CID 166105009) is [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride.
What is the SMILES notation for [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride?
The canonical SMILES for [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride is C[C@H]1CC[C@H](CO)CN1.Cl.
What is the InChIKey of [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride?
The InChIKey is VTNSDDLUAVIRTL-LEUCUCNGSA-N. The full InChI is InChI=1S/C7H15NO.ClH/c1-6-2-3-7(5-9)4-8-6;/h6-9H,2-5H2,1H3;1H/t6-,7-;/m0./s1.
What are the key properties of [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride?
[(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride has a molecular weight of 165.66 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,6S)-6-methylpiperidin-3-yl]methanol;hydrochloride is sourced from PubChem (CID 166105009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).