C26H40F2N6O3 — CID 166105530
1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(6-methyl-2-pyridinyl)prop-2-enyl]-5-propylpyridin-2-one;1-ethyl-3,3-difluoropiperidine;formic acid (PubChem CID 166105530) has the molecular formula C26H40F2N6O3 and a molecular weight of 522.64 g/mol. Its IUPAC name is 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(6-methyl-2-pyridinyl)prop-2-enyl]-5-propylpyridin-2-one;1-ethyl-3,3-difluoropiperidine;formic acid.
| Compound Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(6-methyl-2-pyridinyl)prop-2-enyl]-5-propylpyridin-2-one;1-ethyl-3,3-difluoropiperidine;formic acid |
|---|---|
| PubChem CID | 166105530 |
| Molecular Formula | C26H40F2N6O3 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(6-methyl-2-pyridinyl)prop-2-enyl]-5-propylpyridin-2-one;1-ethyl-3,3-difluoropiperidine;formic acid |
| SMILES | CCCc1ccc(=O)n(C/C(=C(/N)c2cccc(C)n2)N(C)N)c1.CCN1CCCC(F)(F)C1.O=CO |
| InChI | InChI=1S/C18H25N5O.C7H13F2N.CH2O2/c1-4-6-14-9-10-17(24)23(11-14)12-16(22(3)20)18(19)15-8-5-7-13(2)21-15;1-2-10-5-3-4-7(8,9)6-10;2-1-3/h5,7-11H,4,6,12,19-20H2,1-3H3;2-6H2,1H3;1H,(H,2,3)/b18-16-;; |
| InChIKey | RWPAXSQLSWUDDZ-KZYDBBBVSA-N |
| XLogP | 3.08 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|