C21H30N4O5S — CID 166105609
2-[5-[5-[3-(2-ethoxy-2-oxoethyl)cyclohexyl]-6-methyl-2-pyridinyl]-3-methyltriazol-4-yl]ethanesulfonic acid (PubChem CID 166105609) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[5-[5-[3-(2-ethoxy-2-oxoethyl)cyclohexyl]-6-methyl-2-pyridinyl]-3-methyltriazol-4-yl]ethanesulfonic acid.
| Compound Name | 2-[5-[5-[3-(2-ethoxy-2-oxoethyl)cyclohexyl]-6-methyl-2-pyridinyl]-3-methyltriazol-4-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 166105609 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[5-[5-[3-(2-ethoxy-2-oxoethyl)cyclohexyl]-6-methyl-2-pyridinyl]-3-methyltriazol-4-yl]ethanesulfonic acid |
| SMILES | CCOC(=O)CC1CCCC(c2ccc(-c3nnn(C)c3CCS(=O)(=O)O)nc2C)C1 |
| InChI | InChI=1S/C21H30N4O5S/c1-4-30-20(26)13-15-6-5-7-16(12-15)17-8-9-18(22-14(17)2)21-19(25(3)24-23-21)10-11-31(27,28)29/h8-9,15-16H,4-7,10-13H2,1-3H3,(H,27,28,29) |
| InChIKey | CRFGJWSDAJXQCG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|