C23H36N4O5 — CID 166106016
tert-butyl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;toluene (PubChem CID 166106016) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;toluene.
| Compound Name | tert-butyl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;toluene |
|---|---|
| PubChem CID | 166106016 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;toluene |
| SMILES | Cc1ccccc1.[H]/N=C/C(=O)CCC(NC(=O)CNC(=O)CN(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N4O5.C7H8/c1-16(2,3)25-15(24)12(7-6-11(21)8-17)19-13(22)9-18-14(23)10-20(4)5;1-7-5-3-2-4-6-7/h8,12,17H,6-7,9-10H2,1-5H3,(H,18,23)(H,19,22);2-6H,1H3/b17-8+; |
| InChIKey | WZEGWLHLZNFLLC-XIDBHWPPSA-N |
| XLogP | 1.48 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|