About methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate
methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate (PubChem CID 166106222) has the molecular formula C14H12BrF2NO3
and a molecular weight of 360.15 g/mol. Its IUPAC name is methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate |
| PubChem CID | 166106222 |
| Molecular Formula | C14H12BrF2NO3 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate |
| SMILES | COC(=O)CN1C[C@@]2(CC2F)c2c(ccc(Br)c2F)C1=O |
| InChI | InChI=1S/C14H12BrF2NO3/c1-21-10(19)5-18-6-14(4-9(14)16)11-7(13(18)20)2-3-8(15)12(11)17/h2-3,9H,4-6H2,1H3/t9?,14-/m1/s1 |
| InChIKey | RFXCOAVXWHYYDN-IWSPRGBSSA-N |
| XLogP | 2.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate?
The IUPAC name of methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate (CID 166106222) is methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate.
What is the SMILES notation for methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate?
The canonical SMILES for methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate is COC(=O)CN1C[C@@]2(CC2F)c2c(ccc(Br)c2F)C1=O.
What is the InChIKey of methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate?
The InChIKey is RFXCOAVXWHYYDN-IWSPRGBSSA-N. The full InChI is InChI=1S/C14H12BrF2NO3/c1-21-10(19)5-18-6-14(4-9(14)16)11-7(13(18)20)2-3-8(15)12(11)17/h2-3,9H,4-6H2,1H3/t9?,14-/m1/s1.
What are the key properties of methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate?
methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate has a molecular weight of 360.15 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4R)-6-bromo-2',5-difluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetate is sourced from PubChem (CID 166106222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).