C21H24N4O3S — CID 16610630
N-[4-[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 16610630) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[4-[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16610630 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[4-[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(CN2C(=O)NC3(CCCCCC3)C2=O)cs1 |
| InChI | InChI=1S/C21H24N4O3S/c1-15(26)25(17-9-5-4-6-10-17)20-22-16(14-29-20)13-24-18(27)21(23-19(24)28)11-7-2-3-8-12-21/h4-6,9-10,14H,2-3,7-8,11-13H2,1H3,(H,23,28) |
| InChIKey | JRIWWFRCZZVNPN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|