C14H17N5O3S — CID 166106685
(1R,2R,3S,6S,7R)-2-(6-amino-2-methylsulfanylpurin-9-yl)-6-(hydroxymethyl)tricyclo[3.2.0.03,6]heptane-1,7-diol (PubChem CID 166106685) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is (1R,2R,3S,6S,7R)-2-(6-amino-2-methylsulfanylpurin-9-yl)-6-(hydroxymethyl)tricyclo[3.2.0.03,6]heptane-1,7-diol.
| Compound Name | (1R,2R,3S,6S,7R)-2-(6-amino-2-methylsulfanylpurin-9-yl)-6-(hydroxymethyl)tricyclo[3.2.0.03,6]heptane-1,7-diol |
|---|---|
| PubChem CID | 166106685 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (1R,2R,3S,6S,7R)-2-(6-amino-2-methylsulfanylpurin-9-yl)-6-(hydroxymethyl)tricyclo[3.2.0.03,6]heptane-1,7-diol |
| SMILES | CSc1nc(N)c2ncn([C@@H]3[C@H]4CC5[C@]3(O)[C@H](O)[C@]54CO)c2n1 |
| InChI | InChI=1S/C14H17N5O3S/c1-23-12-17-9(15)7-10(18-12)19(4-16-7)8-5-2-6-13(5,3-20)11(21)14(6,8)22/h4-6,8,11,20-22H,2-3H2,1H3,(H2,15,17,18)/t5-,6?,8-,11-,13+,14-/m1/s1 |
| InChIKey | KQARIZFPHNUBLS-ICDOUZGRSA-N |
| XLogP | -0.59 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |