C20H16ClF3N6 — CID 166107122
6-chloro-3-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene (PubChem CID 166107122) has the molecular formula C20H16ClF3N6 and a molecular weight of 432.84 g/mol. Its IUPAC name is 6-chloro-3-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene.
| Compound Name | 6-chloro-3-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 166107122 |
| Molecular Formula | C20H16ClF3N6 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 6-chloro-3-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
| SMILES | Cn1cc(C(F)(F)F)nc1-c1ccc(Cn2nc3c4c(nc(Cl)nc42)CCC3)cc1 |
| InChI | InChI=1S/C20H16ClF3N6/c1-29-10-15(20(22,23)24)26-17(29)12-7-5-11(6-8-12)9-30-18-16-13(25-19(21)27-18)3-2-4-14(16)28-30/h5-8,10H,2-4,9H2,1H3 |
| InChIKey | FWTKLKLCAFWZKE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |