About 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide
3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide (PubChem CID 166107175) has the molecular formula C10H8N4O
and a molecular weight of 200.20 g/mol. Its IUPAC name is 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide.
Molecular Properties
| Compound Name | 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide |
| PubChem CID | 166107175 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]c3[nH]ncc3c2c1 |
| InChI | InChI=1S/C10H8N4O/c11-9(15)5-1-2-8-6(3-5)7-4-12-14-10(7)13-8/h1-4H,(H2,11,15)(H2,12,13,14) |
| InChIKey | FYOUTFXWOYBUPO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide?
The IUPAC name of 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide (CID 166107175) is 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide.
What is the SMILES notation for 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide?
The canonical SMILES for 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide is NC(=O)c1ccc2[nH]c3[nH]ncc3c2c1.
What is the InChIKey of 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide?
The InChIKey is FYOUTFXWOYBUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O/c11-9(15)5-1-2-8-6(3-5)7-4-12-14-10(7)13-8/h1-4H,(H2,11,15)(H2,12,13,14).
What are the key properties of 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide?
3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide has a molecular weight of 200.20 g/mol, XLogP of 1.14, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide is sourced from PubChem (CID 166107175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).