C10H8N4O — CID 166107175
3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide (PubChem CID 166107175) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide.
| Compound Name | 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide |
|---|---|
| PubChem CID | 166107175 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3,4-dihydropyrazolo[5,4-b]indole-7-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]c3[nH]ncc3c2c1 |
| InChI | InChI=1S/C10H8N4O/c11-9(15)5-1-2-8-6(3-5)7-4-12-14-10(7)13-8/h1-4H,(H2,11,15)(H2,12,13,14) |
| InChIKey | FYOUTFXWOYBUPO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |