About CID 166107318
CID 166107318 (PubChem CID 166107318) has the molecular formula C7H11BFNO2
and a molecular weight of 170.98 g/mol.
Molecular Properties
| Compound Name | CID 166107318 |
| PubChem CID | 166107318 |
| Molecular Formula | C7H11BFNO2 |
| Molecular Weight | 170.98 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | — |
| SMILES | [B]/C=C/CNC(=O)COCCF |
| InChI | InChI=1S/C7H11BFNO2/c8-2-1-4-10-7(11)6-12-5-3-9/h1-2H,3-6H2,(H,10,11)/b2-1+ |
| InChIKey | YRACAWLURPRSBC-OWOJBTEDSA-N |
| XLogP | -0.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.98 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166107318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166107318?
The IUPAC name of CID 166107318 (CID 166107318) is not available.
What is the SMILES notation for CID 166107318?
The canonical SMILES for CID 166107318 is [B]/C=C/CNC(=O)COCCF.
What is the InChIKey of CID 166107318?
The InChIKey is YRACAWLURPRSBC-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H11BFNO2/c8-2-1-4-10-7(11)6-12-5-3-9/h1-2H,3-6H2,(H,10,11)/b2-1+.
What are the key properties of CID 166107318?
CID 166107318 has a molecular weight of 170.98 g/mol, XLogP of -0.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166107318 is sourced from PubChem (CID 166107318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).