About 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium
1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium (PubChem CID 166108114) has the molecular formula C9H8BrF3OY-2
and a molecular weight of 357.97 g/mol. Its IUPAC name is 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium.
Molecular Properties
| Compound Name | 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium |
| PubChem CID | 166108114 |
| Molecular Formula | C9H8BrF3OY-2 |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 356.88 |
| IUPAC Name | 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium |
| SMILES | COc1cc(C(F)(F)F)[c-]cc1Br.[CH3-].[Y] |
| InChI | InChI=1S/C8H5BrF3O.CH3.Y/c1-13-7-4-5(8(10,11)12)2-3-6(7)9;;/h3-4H,1H3;1H3;/q2*-1; |
| InChIKey | SHTYWYCNOBTZDA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium?
The IUPAC name of 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium (CID 166108114) is 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium.
What is the SMILES notation for 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium?
The canonical SMILES for 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium is COc1cc(C(F)(F)F)[c-]cc1Br.[CH3-].[Y].
What is the InChIKey of 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium?
The InChIKey is SHTYWYCNOBTZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF3O.CH3.Y/c1-13-7-4-5(8(10,11)12)2-3-6(7)9;;/h3-4H,1H3;1H3;/q2*-1;.
What are the key properties of 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium?
1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium has a molecular weight of 357.97 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methoxy-4-(trifluoromethyl)benzene-5-ide;carbanide;yttrium is sourced from PubChem (CID 166108114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).