C17H18N4O4 — CID 16610816
1-butyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 16610816) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-butyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-butyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 16610816 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-butyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CCCCN1C(=O)C(=O)N(Cc2cc(=O)n3cc(C)ccc3n2)C1=O |
| InChI | InChI=1S/C17H18N4O4/c1-3-4-7-19-15(23)16(24)21(17(19)25)10-12-8-14(22)20-9-11(2)5-6-13(20)18-12/h5-6,8-9H,3-4,7,10H2,1-2H3 |
| InChIKey | NKVOVEDSQRGTHT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|