About (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile
(3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile (PubChem CID 166108302) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile |
| PubChem CID | 166108302 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile |
| SMILES | C=C/C(=C\C(C)=C/C)C(C#N)=C1CCNCC1 |
| InChI | InChI=1S/C15H20N2/c1-4-12(3)10-13(5-2)15(11-16)14-6-8-17-9-7-14/h4-5,10,17H,2,6-9H2,1,3H3/b12-4-,13-10+ |
| InChIKey | PARCASFZARJGNL-QDFYCOOBSA-N |
| XLogP | 3.27 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile?
The IUPAC name of (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile (CID 166108302) is (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile.
What is the SMILES notation for (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile?
The canonical SMILES for (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile is C=C/C(=C\C(C)=C/C)C(C#N)=C1CCNCC1.
What is the InChIKey of (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile?
The InChIKey is PARCASFZARJGNL-QDFYCOOBSA-N. The full InChI is InChI=1S/C15H20N2/c1-4-12(3)10-13(5-2)15(11-16)14-6-8-17-9-7-14/h4-5,10,17H,2,6-9H2,1,3H3/b12-4-,13-10+.
What are the key properties of (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile?
(3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile has a molecular weight of 228.34 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-ethenyl-5-methyl-2-piperidin-4-ylidenehepta-3,5-dienenitrile is sourced from PubChem (CID 166108302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).