About dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium
dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium (PubChem CID 166108406) has the molecular formula C15H18FN3Y-2
and a molecular weight of 348.23 g/mol. Its IUPAC name is dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium.
Molecular Properties
| Compound Name | dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium |
| PubChem CID | 166108406 |
| Molecular Formula | C15H18FN3Y-2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium |
| SMILES | C[N-]C.N#CC(=C1CC[N-]CC1)c1ccc(F)cc1.[Y] |
| InChI | InChI=1S/C13H12FN2.C2H6N.Y/c14-12-3-1-10(2-4-12)13(9-15)11-5-7-16-8-6-11;1-3-2;/h1-4H,5-8H2;1-2H3;/q2*-1; |
| InChIKey | MPFKUTWJVUCGAH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium?
The IUPAC name of dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium (CID 166108406) is dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium.
What is the SMILES notation for dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium?
The canonical SMILES for dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium is C[N-]C.N#CC(=C1CC[N-]CC1)c1ccc(F)cc1.[Y].
What is the InChIKey of dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium?
The InChIKey is MPFKUTWJVUCGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN2.C2H6N.Y/c14-12-3-1-10(2-4-12)13(9-15)11-5-7-16-8-6-11;1-3-2;/h1-4H,5-8H2;1-2H3;/q2*-1;.
What are the key properties of dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium?
dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium has a molecular weight of 348.23 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanide;2-(4-fluorophenyl)-2-piperidin-1-id-4-ylideneacetonitrile;yttrium is sourced from PubChem (CID 166108406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).