C16H14ClN5O — CID 166108419
2-(5-chloro-2-pyridinyl)-2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]acetonitrile (PubChem CID 166108419) has the molecular formula C16H14ClN5O and a molecular weight of 327.77 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]acetonitrile.
| Compound Name | 2-(5-chloro-2-pyridinyl)-2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 166108419 |
| Molecular Formula | C16H14ClN5O |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]acetonitrile |
| SMILES | N#CC(=C1CCN(C(=O)n2ccnc2)CC1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H14ClN5O/c17-13-1-2-15(20-10-13)14(9-18)12-3-6-21(7-4-12)16(23)22-8-5-19-11-22/h1-2,5,8,10-11H,3-4,6-7H2 |
| InChIKey | LMUCGBSWVPFNFU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|