C19H15BrFN3O4 — CID 166108572
N-[6-bromo-2-(oxetan-3-yloxy)-3-pyridinyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 166108572) has the molecular formula C19H15BrFN3O4 and a molecular weight of 448.25 g/mol. Its IUPAC name is N-[6-bromo-2-(oxetan-3-yloxy)-3-pyridinyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[6-bromo-2-(oxetan-3-yloxy)-3-pyridinyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166108572 |
| Molecular Formula | C19H15BrFN3O4 |
| Molecular Weight | 448.25 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-[6-bromo-2-(oxetan-3-yloxy)-3-pyridinyl]-3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccc(F)cc2)c1C(=O)Nc1ccc(Br)nc1OC1COC1 |
| InChI | InChI=1S/C19H15BrFN3O4/c1-10-16(17(24-28-10)11-2-4-12(21)5-3-11)18(25)22-14-6-7-15(20)23-19(14)27-13-8-26-9-13/h2-7,13H,8-9H2,1H3,(H,22,25) |
| InChIKey | XUZNKPJDOSBZEN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|